C23H22F4N4O — CID 25291943
3-fluoro-N-[2-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrazol-3-yl]benzamide (PubChem CID 25291943) has the molecular formula C23H22F4N4O and a molecular weight of 446.45 g/mol. Its IUPAC name is 3-fluoro-N-[2-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrazol-3-yl]benzamide.
| Compound Name | 3-fluoro-N-[2-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 25291943 |
| Molecular Formula | C23H22F4N4O |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3-fluoro-N-[2-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccnn1C1CCN(Cc2ccc(C(F)(F)F)cc2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H22F4N4O/c24-19-3-1-2-17(14-19)22(32)29-21-8-11-28-31(21)20-9-12-30(13-10-20)15-16-4-6-18(7-5-16)23(25,26)27/h1-8,11,14,20H,9-10,12-13,15H2,(H,29,32) |
| InChIKey | UVGXPAJUPHTJPF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |