C22H23FN4O — CID 42302028
N-[2-(1-benzylpiperidin-4-yl)pyrazol-3-yl]-3-fluorobenzamide (PubChem CID 42302028) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)pyrazol-3-yl]-3-fluorobenzamide.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)pyrazol-3-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 42302028 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)pyrazol-3-yl]-3-fluorobenzamide |
| SMILES | O=C(Nc1ccnn1C1CCN(Cc2ccccc2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H23FN4O/c23-19-8-4-7-18(15-19)22(28)25-21-9-12-24-27(21)20-10-13-26(14-11-20)16-17-5-2-1-3-6-17/h1-9,12,15,20H,10-11,13-14,16H2,(H,25,28) |
| InChIKey | YARABJZHZLUNMF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |