C20H28N6O4 — CID 86916462
N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 86916462) has the molecular formula C20H28N6O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 86916462 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | CCN1CCC(n2nccc2NC(=O)c2ccc(NCCOC)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H28N6O4/c1-3-24-11-7-16(8-12-24)25-19(6-9-22-25)23-20(27)15-4-5-17(21-10-13-30-2)18(14-15)26(28)29/h4-6,9,14,16,21H,3,7-8,10-13H2,1-2H3,(H,23,27) |
| InChIKey | DGTWFRUJPDXHAL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|