C20H20FN5O4 — CID 86894060
N-[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 86894060) has the molecular formula C20H20FN5O4 and a molecular weight of 413.41 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 86894060 |
| Molecular Formula | C20H20FN5O4 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | COCCNc1ccc(C(=O)Nc2ccnn2Cc2ccccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20FN5O4/c1-30-11-10-22-17-7-6-14(12-18(17)26(28)29)20(27)24-19-8-9-23-25(19)13-15-4-2-3-5-16(15)21/h2-9,12,22H,10-11,13H2,1H3,(H,24,27) |
| InChIKey | MIYVEAPWZCACIL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|