C16H16IN3O4 — CID 27826592
N-(3-iodophenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 27826592) has the molecular formula C16H16IN3O4 and a molecular weight of 441.23 g/mol. Its IUPAC name is N-(3-iodophenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-(3-iodophenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 27826592 |
| Molecular Formula | C16H16IN3O4 |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | N-(3-iodophenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | COCCNc1ccc(C(=O)Nc2cccc(I)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16IN3O4/c1-24-8-7-18-14-6-5-11(9-15(14)20(22)23)16(21)19-13-4-2-3-12(17)10-13/h2-6,9-10,18H,7-8H2,1H3,(H,19,21) |
| InChIKey | IXWGKCFDVHKOMU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|