C17H18N4O5 — CID 9399328
N-(2-carbamoylphenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 9399328) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-(2-carbamoylphenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 9399328 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-(2-carbamoylphenyl)-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | COCCNc1ccc(C(=O)Nc2ccccc2C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N4O5/c1-26-9-8-19-14-7-6-11(10-15(14)21(24)25)17(23)20-13-5-3-2-4-12(13)16(18)22/h2-7,10,19H,8-9H2,1H3,(H2,18,22)(H,20,23) |
| InChIKey | VDMVREYRQODAQV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|