C22H30N4O5 — CID 55538481
N-[2-[2-(diethylamino)ethoxy]phenyl]-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 55538481) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]phenyl]-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]phenyl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 55538481 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]phenyl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | CCN(CC)CCOc1ccccc1NC(=O)c1ccc(NCCOC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H30N4O5/c1-4-25(5-2)13-15-31-21-9-7-6-8-19(21)24-22(27)17-10-11-18(23-12-14-30-3)20(16-17)26(28)29/h6-11,16,23H,4-5,12-15H2,1-3H3,(H,24,27) |
| InChIKey | IRWNVYRWIRALOM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|