C26H30N4O4 — CID 99182686
4-(benzylamino)-N-[2-[2-(diethylamino)ethoxy]phenyl]-3-nitrobenzamide (PubChem CID 99182686) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-(benzylamino)-N-[2-[2-(diethylamino)ethoxy]phenyl]-3-nitrobenzamide.
| Compound Name | 4-(benzylamino)-N-[2-[2-(diethylamino)ethoxy]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 99182686 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 4-(benzylamino)-N-[2-[2-(diethylamino)ethoxy]phenyl]-3-nitrobenzamide |
| SMILES | CCN(CC)CCOc1ccccc1NC(=O)c1ccc(NCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-29(4-2)16-17-34-25-13-9-8-12-23(25)28-26(31)21-14-15-22(24(18-21)30(32)33)27-19-20-10-6-5-7-11-20/h5-15,18,27H,3-4,16-17,19H2,1-2H3,(H,28,31) |
| InChIKey | QMNSURLQRFDVJA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|