C25H27N5O5 — CID 55957153
4-(2-methoxyethylamino)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-nitrobenzamide (PubChem CID 55957153) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-nitrobenzamide.
| Compound Name | 4-(2-methoxyethylamino)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55957153 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-(2-methoxyethylamino)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-nitrobenzamide |
| SMILES | COCCNc1ccc(C(=O)NCc2cccc(NC(=O)Nc3cccc(C)c3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27N5O5/c1-17-5-3-7-20(13-17)28-25(32)29-21-8-4-6-18(14-21)16-27-24(31)19-9-10-22(26-11-12-35-2)23(15-19)30(33)34/h3-10,13-15,26H,11-12,16H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | OORWWAAIYKPBLL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|