C19H17Cl2N5O3 — CID 16960619
N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(ethylamino)-3-nitrobenzamide (PubChem CID 16960619) has the molecular formula C19H17Cl2N5O3 and a molecular weight of 434.28 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(ethylamino)-3-nitrobenzamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(ethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 16960619 |
| Molecular Formula | C19H17Cl2N5O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(ethylamino)-3-nitrobenzamide |
| SMILES | CCNc1ccc(C(=O)Nc2ccnn2Cc2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17Cl2N5O3/c1-2-22-16-6-4-12(9-17(16)26(28)29)19(27)24-18-7-8-23-25(18)11-13-3-5-14(20)10-15(13)21/h3-10,22H,2,11H2,1H3,(H,24,27) |
| InChIKey | WQLCSXIMSQROFR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|