C13H13Cl2N3O2 — CID 47020457
N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-methoxyacetamide (PubChem CID 47020457) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-methoxyacetamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 47020457 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccnn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-20-8-13(19)17-12-4-5-16-18(12)7-9-2-3-10(14)6-11(9)15/h2-6H,7-8H2,1H3,(H,17,19) |
| InChIKey | ITFLKXKTEKUWDN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |