C16H17Cl2N3O2 — CID 51248287
N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]oxane-4-carboxamide (PubChem CID 51248287) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]oxane-4-carboxamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 51248287 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]oxane-4-carboxamide |
| SMILES | O=C(Nc1ccnn1Cc1ccc(Cl)cc1Cl)C1CCOCC1 |
| InChI | InChI=1S/C16H17Cl2N3O2/c17-13-2-1-12(14(18)9-13)10-21-15(3-6-19-21)20-16(22)11-4-7-23-8-5-11/h1-3,6,9,11H,4-5,7-8,10H2,(H,20,22) |
| InChIKey | AKJIZXHOVMNRIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |