C15H18Cl2N4O — CID 119695467
N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(methylamino)butanamide (PubChem CID 119695467) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(methylamino)butanamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119695467 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccnn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N4O/c1-18-7-2-3-15(22)20-14-6-8-19-21(14)10-11-4-5-12(16)9-13(11)17/h4-6,8-9,18H,2-3,7,10H2,1H3,(H,20,22) |
| InChIKey | SUTAUDVGZDGMDX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|