C20H19Cl2N3O4 — CID 55435526
N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,4,5-trimethoxybenzamide (PubChem CID 55435526) has the molecular formula C20H19Cl2N3O4 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 55435526 |
| Molecular Formula | C20H19Cl2N3O4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccnn2Cc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C20H19Cl2N3O4/c1-27-16-10-18(29-3)17(28-2)9-14(16)20(26)24-19-6-7-23-25(19)11-12-4-5-13(21)8-15(12)22/h4-10H,11H2,1-3H3,(H,24,26) |
| InChIKey | KJWFFKGZLUWOAI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |