C21H19Cl2N3O3 — CID 16567964
(E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 16567964) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is (E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16567964 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccnn2Cc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C21H19Cl2N3O3/c1-28-17-7-4-14(19(12-17)29-2)5-8-21(27)25-20-9-10-24-26(20)13-15-3-6-16(22)11-18(15)23/h3-12H,13H2,1-2H3,(H,25,27)/b8-5+ |
| InChIKey | RQBUGWQTGHURDP-VMPITWQZSA-N |
| XLogP | 4.91 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|