C21H19Cl2N3O2 — CID 18267641
(E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 18267641) has the molecular formula C21H19Cl2N3O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is (E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18267641 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (E)-N-[2-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccnn2Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2N3O2/c1-2-28-18-8-3-15(4-9-18)5-10-21(27)25-20-11-12-24-26(20)14-16-6-7-17(22)13-19(16)23/h3-13H,2,14H2,1H3,(H,25,27)/b10-5+ |
| InChIKey | GIQDNUNFXQZMBN-BJMVGYQFSA-N |
| XLogP | 5.29 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|