C20H24N4O — CID 119110720
3-[[(4-cyanophenyl)methylamino]methyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 119110720) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[[(4-cyanophenyl)methylamino]methyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[[(4-cyanophenyl)methylamino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 119110720 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[[(4-cyanophenyl)methylamino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(CNCc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C20H24N4O/c1-24(2)11-10-23-20(25)19-5-3-4-18(12-19)15-22-14-17-8-6-16(13-21)7-9-17/h3-9,12,22H,10-11,14-15H2,1-2H3,(H,23,25) |
| InChIKey | WELVJKJDQFLHRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |