C26H27N5O2 — CID 59190831
3-[[(4-cyanophenyl)carbamoylamino]methyl]-N-[4-[2-(dimethylamino)ethyl]phenyl]benzamide (PubChem CID 59190831) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 3-[[(4-cyanophenyl)carbamoylamino]methyl]-N-[4-[2-(dimethylamino)ethyl]phenyl]benzamide.
| Compound Name | 3-[[(4-cyanophenyl)carbamoylamino]methyl]-N-[4-[2-(dimethylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59190831 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-[[(4-cyanophenyl)carbamoylamino]methyl]-N-[4-[2-(dimethylamino)ethyl]phenyl]benzamide |
| SMILES | CN(C)CCc1ccc(NC(=O)c2cccc(CNC(=O)Nc3ccc(C#N)cc3)c2)cc1 |
| InChI | InChI=1S/C26H27N5O2/c1-31(2)15-14-19-6-10-23(11-7-19)29-25(32)22-5-3-4-21(16-22)18-28-26(33)30-24-12-8-20(17-27)9-13-24/h3-13,16H,14-15,18H2,1-2H3,(H,29,32)(H2,28,30,33) |
| InChIKey | RQLGHFOGWQQAPP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |