C19H31ClN2O3 — CID 119111278
N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-1-morpholin-4-ylpropan-2-amine (PubChem CID 119111278) has the molecular formula C19H31ClN2O3 and a molecular weight of 370.92 g/mol. Its IUPAC name is N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-1-morpholin-4-ylpropan-2-amine.
| Compound Name | N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-1-morpholin-4-ylpropan-2-amine |
|---|---|
| PubChem CID | 119111278 |
| Molecular Formula | C19H31ClN2O3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-1-morpholin-4-ylpropan-2-amine |
| SMILES | CCCOc1c(Cl)cc(CNC(C)CN2CCOCC2)cc1OCC |
| InChI | InChI=1S/C19H31ClN2O3/c1-4-8-25-19-17(20)11-16(12-18(19)24-5-2)13-21-15(3)14-22-6-9-23-10-7-22/h11-12,15,21H,4-10,13-14H2,1-3H3 |
| InChIKey | HCYCTFXNMYCFOK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |