C20H34ClN3O2 — CID 119122987
N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 119122987) has the molecular formula C20H34ClN3O2 and a molecular weight of 383.96 g/mol. Its IUPAC name is N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 119122987 |
| Molecular Formula | C20H34ClN3O2 |
| Molecular Weight | 383.96 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CCCOc1c(Cl)cc(CNCC(C)N2CCN(C)CC2)cc1OCC |
| InChI | InChI=1S/C20H34ClN3O2/c1-5-11-26-20-18(21)12-17(13-19(20)25-6-2)15-22-14-16(3)24-9-7-23(4)8-10-24/h12-13,16,22H,5-11,14-15H2,1-4H3 |
| InChIKey | LHUJEHUPTQGWMA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.96 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |