C22H31N3O3S — CID 11911134
2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 11911134) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 11911134 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc2ccccc2c(=O)n1[C@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C22H31N3O3S/c1-15-8-6-11-19(16(15)2)25-21(27)17-9-4-5-10-18(17)24-22(25)29-14-20(26)23-12-7-13-28-3/h4-5,9-10,15-16,19H,6-8,11-14H2,1-3H3,(H,23,26)/t15-,16-,19+/m1/s1 |
| InChIKey | YBSLGGIMIYFBAD-MDZRGWNJSA-N |
| XLogP | 3.64 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|