C20H27N3O2S — CID 11924320
N-[2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylethyl]acetamide (PubChem CID 11924320) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylethyl]acetamide.
| Compound Name | N-[2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 11924320 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[2-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylethyl]acetamide |
| SMILES | CC(=O)NCCSc1nc2ccccc2c(=O)n1[C@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C20H27N3O2S/c1-13-7-6-10-18(14(13)2)23-19(25)16-8-4-5-9-17(16)22-20(23)26-12-11-21-15(3)24/h4-5,8-9,13-14,18H,6-7,10-12H2,1-3H3,(H,21,24)/t13-,14-,18+/m1/s1 |
| InChIKey | UASLYSCCBBEEMT-LBTNJELSSA-N |
| XLogP | 3.62 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|