C20H25N3OS — CID 11911143
4-[3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylbutanenitrile (PubChem CID 11911143) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 4-[3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylbutanenitrile.
| Compound Name | 4-[3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylbutanenitrile |
|---|---|
| PubChem CID | 11911143 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-[3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxoquinazolin-2-yl]sulfanylbutanenitrile |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1n1c(SCCCC#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H25N3OS/c1-14-8-7-11-18(15(14)2)23-19(24)16-9-3-4-10-17(16)22-20(23)25-13-6-5-12-21/h3-4,9-10,14-15,18H,5-8,11,13H2,1-2H3/t14-,15-,18-/m1/s1 |
| InChIKey | LLKZWRUIIBCJLB-IIDMSEBBSA-N |
| XLogP | 4.79 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|