C12H13BrFN3 — CID 119111554
2-(5-bromo-2-fluorophenyl)-N-(1H-imidazol-2-ylmethyl)ethanamine (PubChem CID 119111554) has the molecular formula C12H13BrFN3 and a molecular weight of 298.16 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-N-(1H-imidazol-2-ylmethyl)ethanamine.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-N-(1H-imidazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 119111554 |
| Molecular Formula | C12H13BrFN3 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-N-(1H-imidazol-2-ylmethyl)ethanamine |
| SMILES | Fc1ccc(Br)cc1CCNCc1ncc[nH]1 |
| InChI | InChI=1S/C12H13BrFN3/c13-10-1-2-11(14)9(7-10)3-4-15-8-12-16-5-6-17-12/h1-2,5-7,15H,3-4,8H2,(H,16,17) |
| InChIKey | LJZLDLVTDBWSCK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|