C12H14BrN3O — CID 63820703
1-(5-bromo-2-methoxyphenyl)-N-(1H-imidazol-2-ylmethyl)methanamine (PubChem CID 63820703) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-N-(1H-imidazol-2-ylmethyl)methanamine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-N-(1H-imidazol-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 63820703 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-N-(1H-imidazol-2-ylmethyl)methanamine |
| SMILES | COc1ccc(Br)cc1CNCc1ncc[nH]1 |
| InChI | InChI=1S/C12H14BrN3O/c1-17-11-3-2-10(13)6-9(11)7-14-8-12-15-4-5-16-12/h2-6,14H,7-8H2,1H3,(H,15,16) |
| InChIKey | FCTHHAIJOXBCBR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |