C19H29NO4 — CID 119114121
5-[1-(4-methoxyphenyl)pentylamino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 119114121) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 5-[1-(4-methoxyphenyl)pentylamino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[1-(4-methoxyphenyl)pentylamino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 119114121 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 5-[1-(4-methoxyphenyl)pentylamino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCCCC(NC(=O)CC(C)(C)CC(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-6-7-16(14-8-10-15(24-4)11-9-14)20-17(21)12-19(2,3)13-18(22)23/h8-11,16H,5-7,12-13H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | MGVCJZLNXGYQNJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |