C18H28N2O4 — CID 122000754
3-[1-(4-methoxyphenyl)pentylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122000754) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)pentylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[1-(4-methoxyphenyl)pentylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122000754 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)pentylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCCCC(NC(=O)N(C)CC(C)C(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-5-6-7-16(14-8-10-15(24-4)11-9-14)19-18(23)20(3)12-13(2)17(21)22/h8-11,13,16H,5-7,12H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | OKHVQSSMAUSTDO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |