C10H18N6 — CID 119114636
N'-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 119114636) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is N'-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119114636 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | N'-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCn1cncn1)N1CCCC1 |
| InChI | InChI=1S/C10H18N6/c1-11-10(15-5-2-3-6-15)13-4-7-16-9-12-8-14-16/h8-9H,2-7H2,1H3,(H,11,13) |
| InChIKey | GUOLRIANIKDKPU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|