C15H21N7 — CID 119116185
1-cyclopropyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 119116185) has the molecular formula C15H21N7 and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-cyclopropyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119116185 |
| Molecular Formula | C15H21N7 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-cyclopropyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccccn2)NC2CC2)n1C |
| InChI | InChI=1S/C15H21N7/c1-11-20-21-14(22(11)2)10-18-15(19-12-6-7-12)17-9-13-5-3-4-8-16-13/h3-5,8,12H,6-7,9-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | XHPDYMWUGDDEKH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|