C18H23IN4O2S — CID 119116385
N-[[4-(methanesulfonamido)phenyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 119116385) has the molecular formula C18H23IN4O2S and a molecular weight of 486.38 g/mol. Its IUPAC name is N-[[4-(methanesulfonamido)phenyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[[4-(methanesulfonamido)phenyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119116385 |
| Molecular Formula | C18H23IN4O2S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N-[[4-(methanesulfonamido)phenyl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NS(C)(=O)=O)cc1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C18H22N4O2S.HI/c1-19-18(22-12-11-15-5-3-4-6-17(15)22)20-13-14-7-9-16(10-8-14)21-25(2,23)24;/h3-10,21H,11-13H2,1-2H3,(H,19,20);1H |
| InChIKey | QQIATWJJCSGZBB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|