C17H23N5 — CID 119119668
1-cyclohexyl-2-[(1-phenylpyrazol-3-yl)methyl]guanidine (PubChem CID 119119668) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(1-phenylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119119668 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-cyclohexyl-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccn(-c2ccccc2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C17H23N5/c18-17(20-14-7-3-1-4-8-14)19-13-15-11-12-22(21-15)16-9-5-2-6-10-16/h2,5-6,9-12,14H,1,3-4,7-8,13H2,(H3,18,19,20) |
| InChIKey | CQOZTJASAVLTLS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|