C20H27N5 — CID 119119704
1-cyclohexyl-2-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]guanidine (PubChem CID 119119704) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119119704 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-cyclohexyl-2-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]guanidine |
| SMILES | N/C(=N\Cc1nn(-c2ccccc2)c2c1CCC2)NC1CCCCC1 |
| InChI | InChI=1S/C20H27N5/c21-20(23-15-8-3-1-4-9-15)22-14-18-17-12-7-13-19(17)25(24-18)16-10-5-2-6-11-16/h2,5-6,10-11,15H,1,3-4,7-9,12-14H2,(H3,21,22,23) |
| InChIKey | YJRDCBFTFYBNDX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|