C21H27NO3S — CID 119121928
3-benzylsulfonyl-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine (PubChem CID 119121928) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine.
| Compound Name | 3-benzylsulfonyl-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 119121928 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-benzylsulfonyl-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine |
| SMILES | CC1(C)Cc2cc(CNCCCS(=O)(=O)Cc3ccccc3)ccc2O1 |
| InChI | InChI=1S/C21H27NO3S/c1-21(2)14-19-13-18(9-10-20(19)25-21)15-22-11-6-12-26(23,24)16-17-7-4-3-5-8-17/h3-5,7-10,13,22H,6,11-12,14-16H2,1-2H3 |
| InChIKey | GNZJLWYSSDAGOU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|