C14H21NO — CID 63270798
N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine (PubChem CID 63270798) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63270798 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1ccc2c(c1)CC(C)(C)O2 |
| InChI | InChI=1S/C14H21NO/c1-4-7-15-10-11-5-6-13-12(8-11)9-14(2,3)16-13/h5-6,8,15H,4,7,9-10H2,1-3H3 |
| InChIKey | HXAVMMNBXWHJGC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|