C20H31N3O2 — CID 119122606
1-(1,3-dimethylpyrazol-4-yl)-N-[(4-methoxy-3-pentoxyphenyl)methyl]ethanamine (PubChem CID 119122606) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-N-[(4-methoxy-3-pentoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-N-[(4-methoxy-3-pentoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 119122606 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-N-[(4-methoxy-3-pentoxyphenyl)methyl]ethanamine |
| SMILES | CCCCCOc1cc(CNC(C)c2cn(C)nc2C)ccc1OC |
| InChI | InChI=1S/C20H31N3O2/c1-6-7-8-11-25-20-12-17(9-10-19(20)24-5)13-21-15(2)18-14-23(4)22-16(18)3/h9-10,12,14-15,21H,6-8,11,13H2,1-5H3 |
| InChIKey | IQXINTRJVMMLNG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|