C13H15F2N3O — CID 119123236
1-[3-(difluoromethoxy)phenyl]-N-[(3-methylimidazol-4-yl)methyl]methanamine (PubChem CID 119123236) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-N-[(3-methylimidazol-4-yl)methyl]methanamine.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-N-[(3-methylimidazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 119123236 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-N-[(3-methylimidazol-4-yl)methyl]methanamine |
| SMILES | Cn1cncc1CNCc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H15F2N3O/c1-18-9-17-8-11(18)7-16-6-10-3-2-4-12(5-10)19-13(14)15/h2-5,8-9,13,16H,6-7H2,1H3 |
| InChIKey | CXDDJRCYVGXLJL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |