C20H24ClNO3 — CID 119124485
5-[[[4-(2-chlorophenyl)oxan-4-yl]methylamino]methyl]-2-methoxyphenol (PubChem CID 119124485) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is 5-[[[4-(2-chlorophenyl)oxan-4-yl]methylamino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[4-(2-chlorophenyl)oxan-4-yl]methylamino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 119124485 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 5-[[[4-(2-chlorophenyl)oxan-4-yl]methylamino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNCC2(c3ccccc3Cl)CCOCC2)cc1O |
| InChI | InChI=1S/C20H24ClNO3/c1-24-19-7-6-15(12-18(19)23)13-22-14-20(8-10-25-11-9-20)16-4-2-3-5-17(16)21/h2-7,12,22-23H,8-11,13-14H2,1H3 |
| InChIKey | GMZJEPAOFZNLKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |