C24H33N3O2 — CID 119125453
N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methanamine (PubChem CID 119125453) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methanamine.
| Compound Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 119125453 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methanamine |
| SMILES | C=C(C)COc1cc(CNCc2ccnc(N3CCCCCC3)c2)ccc1OC |
| InChI | InChI=1S/C24H33N3O2/c1-19(2)18-29-23-14-20(8-9-22(23)28-3)16-25-17-21-10-11-26-24(15-21)27-12-6-4-5-7-13-27/h8-11,14-15,25H,1,4-7,12-13,16-18H2,2-3H3 |
| InChIKey | CBCAMMFUCMJZRZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|