C18H17FN2O5 — CID 119125471
5-[[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 119125471) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is 5-[[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119125471 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-[[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | O=C(Nc1cc(F)ccc1OCC1CCCO1)c1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C18H17FN2O5/c19-12-4-6-16(26-10-13-2-1-7-25-13)15(8-12)21-17(22)11-3-5-14(18(23)24)20-9-11/h3-6,8-9,13H,1-2,7,10H2,(H,21,22)(H,23,24) |
| InChIKey | XUFCESIKHFTFAO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |