C16H16FNO3S — CID 95330766
N-[5-fluoro-2-[[(2R)-oxolan-2-yl]methoxy]phenyl]thiophene-3-carboxamide (PubChem CID 95330766) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is N-[5-fluoro-2-[[(2R)-oxolan-2-yl]methoxy]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[5-fluoro-2-[[(2R)-oxolan-2-yl]methoxy]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 95330766 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[5-fluoro-2-[[(2R)-oxolan-2-yl]methoxy]phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1OC[C@H]1CCCO1)c1ccsc1 |
| InChI | InChI=1S/C16H16FNO3S/c17-12-3-4-15(21-9-13-2-1-6-20-13)14(8-12)18-16(19)11-5-7-22-10-11/h3-5,7-8,10,13H,1-2,6,9H2,(H,18,19)/t13-/m1/s1 |
| InChIKey | ORSHHZVFQHISEI-CYBMUJFWSA-N |
| XLogP | 3.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |