C13H18N4O — CID 119126182
N-(1H-imidazol-2-ylmethyl)-1-(6-propoxy-3-pyridinyl)methanamine (PubChem CID 119126182) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-1-(6-propoxy-3-pyridinyl)methanamine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-1-(6-propoxy-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 119126182 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-1-(6-propoxy-3-pyridinyl)methanamine |
| SMILES | CCCOc1ccc(CNCc2ncc[nH]2)cn1 |
| InChI | InChI=1S/C13H18N4O/c1-2-7-18-13-4-3-11(9-17-13)8-14-10-12-15-5-6-16-12/h3-6,9,14H,2,7-8,10H2,1H3,(H,15,16) |
| InChIKey | XEDSSCXQXKHAGP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |