C18H21F2NO2 — CID 119126832
1-[3-(difluoromethoxy)phenyl]-N-[(4-methoxy-3-methylphenyl)methyl]ethanamine (PubChem CID 119126832) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-N-[(4-methoxy-3-methylphenyl)methyl]ethanamine.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-N-[(4-methoxy-3-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 119126832 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-N-[(4-methoxy-3-methylphenyl)methyl]ethanamine |
| SMILES | COc1ccc(CNC(C)c2cccc(OC(F)F)c2)cc1C |
| InChI | InChI=1S/C18H21F2NO2/c1-12-9-14(7-8-17(12)22-3)11-21-13(2)15-5-4-6-16(10-15)23-18(19)20/h4-10,13,18,21H,11H2,1-3H3 |
| InChIKey | QJJLWXGDRNHNCS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|