C22H22F2N2O2 — CID 22391576
N-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-(3-methoxyphenyl)ethanamine (PubChem CID 22391576) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-(3-methoxyphenyl)ethanamine.
| Compound Name | N-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 22391576 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(C(C)NCc2ccc(OC(F)F)c(-c3cccnc3)c2)c1 |
| InChI | InChI=1S/C22H22F2N2O2/c1-15(17-5-3-7-19(12-17)27-2)26-13-16-8-9-21(28-22(23)24)20(11-16)18-6-4-10-25-14-18/h3-12,14-15,22,26H,13H2,1-2H3 |
| InChIKey | SJDRCMZXABNNQD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |