C26H28N2O2 — CID 22391610
N-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine (PubChem CID 22391610) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine.
| Compound Name | N-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 22391610 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(C(C)NCc2ccc(OC)c(-c3ccc4ccn(C)c4c3)c2)c1 |
| InChI | InChI=1S/C26H28N2O2/c1-18(21-6-5-7-23(15-21)29-3)27-17-19-8-11-26(30-4)24(14-19)22-10-9-20-12-13-28(2)25(20)16-22/h5-16,18,27H,17H2,1-4H3 |
| InChIKey | IPRYNHOAPVETKX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |