C16H18Cl2N4 — CID 119127375
N-[(3,4-dichlorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 119127375) has the molecular formula C16H18Cl2N4 and a molecular weight of 337.25 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 119127375 |
| Molecular Formula | C16H18Cl2N4 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | Clc1ccc(CNC2CCCN(c3cccnn3)C2)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N4/c17-14-6-5-12(9-15(14)18)10-19-13-3-2-8-22(11-13)16-4-1-7-20-21-16/h1,4-7,9,13,19H,2-3,8,10-11H2 |
| InChIKey | XQHSJHIMXKSDOW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |