C16H18ClFN4 — CID 129375184
(3S)-N-[(2-chloro-4-fluorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 129375184) has the molecular formula C16H18ClFN4 and a molecular weight of 320.80 g/mol. Its IUPAC name is (3S)-N-[(2-chloro-4-fluorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | (3S)-N-[(2-chloro-4-fluorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 129375184 |
| Molecular Formula | C16H18ClFN4 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (3S)-N-[(2-chloro-4-fluorophenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | Fc1ccc(CN[C@H]2CCCN(c3cccnn3)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClFN4/c17-15-9-13(18)6-5-12(15)10-19-14-3-2-8-22(11-14)16-4-1-7-20-21-16/h1,4-7,9,14,19H,2-3,8,10-11H2/t14-/m0/s1 |
| InChIKey | SKIIEIVZBCPOJN-AWEZNQCLSA-N |
| XLogP | 3.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |