C17H21FN4O — CID 95338968
(1R)-1-(4-fluorophenyl)-2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]ethanol (PubChem CID 95338968) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is (1R)-1-(4-fluorophenyl)-2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]ethanol.
| Compound Name | (1R)-1-(4-fluorophenyl)-2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 95338968 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1R)-1-(4-fluorophenyl)-2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]ethanol |
| SMILES | O[C@@H](CN[C@@H]1CCCN(c2cccnn2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN4O/c18-14-7-5-13(6-8-14)16(23)11-19-15-3-2-10-22(12-15)17-4-1-9-20-21-17/h1,4-9,15-16,19,23H,2-3,10-12H2/t15-,16+/m1/s1 |
| InChIKey | ACOLBAAUDSWFKP-CVEARBPZSA-N |
| XLogP | 1.91 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |