C18H24N4O2 — CID 95321454
(3R)-N-[(2,5-dimethoxyphenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 95321454) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (3R)-N-[(2,5-dimethoxyphenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | (3R)-N-[(2,5-dimethoxyphenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 95321454 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3R)-N-[(2,5-dimethoxyphenyl)methyl]-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | COc1ccc(OC)c(CN[C@@H]2CCCN(c3cccnn3)C2)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-23-16-7-8-17(24-2)14(11-16)12-19-15-5-4-10-22(13-15)18-6-3-9-20-21-18/h3,6-9,11,15,19H,4-5,10,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | AVMQGQNBQZRCMS-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |