C15H16ClN5O — CID 119127785
2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine (PubChem CID 119127785) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 119127785 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine |
| SMILES | Cc1[nH]ncc1CNCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C15H16ClN5O/c1-10-12(9-18-20-10)8-17-7-6-14-19-15(21-22-14)11-2-4-13(16)5-3-11/h2-5,9,17H,6-8H2,1H3,(H,18,20) |
| InChIKey | XXNWCASTGRGZMR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|