C16H19ClN6O — CID 166235155
2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(3-ethyl-5-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 166235155) has the molecular formula C16H19ClN6O and a molecular weight of 346.82 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(3-ethyl-5-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(3-ethyl-5-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 166235155 |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[(3-ethyl-5-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCn1nnc(C)c1CNCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C16H19ClN6O/c1-3-23-14(11(2)20-22-23)10-18-9-8-15-19-16(21-24-15)12-4-6-13(17)7-5-12/h4-7,18H,3,8-10H2,1-2H3 |
| InChIKey | CNGDVUQDCMDZDY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|